Pattern Recognition in Maths — Seeing What Others Miss

Learn pattern recognition in maths with clear explanations, worked examples, and practice problems.

CBSE JEE-MAIN NEET 11 min read

Pattern recognition is the skill of finding a rule in a sequence or structure, then using that rule to predict or prove something. It’s not a single topic in the syllabus — it’s the meta-skill that makes you faster at every topic.

When you see a pattern in a number sequence, a geometric figure, or an algebraic expression, you’ve done the hard part. The calculation that follows is just mechanics.

Every great mathematician described the same experience: they didn’t grind through problems, they saw something. That seeing is pattern recognition, and it’s trainable.

Key Terms and What They Mean

Sequence: An ordered list of numbers (or objects) following a rule. The rule can be arithmetic, geometric, recursive, or something more exotic.

Pattern: A regularity or rule that describes how elements in a sequence or structure relate to each other.

Generalisation: Expressing a pattern as a formula or statement that works for all cases, not just the ones you checked.

Inductive reasoning: Observing specific cases → inferring a general rule. (Note: this is observation-based, not proof. Mathematical proof requires deduction.)

Recursive rule: A pattern where each term is defined in terms of previous terms (e.g., Fibonacci: Fn=Fn1+Fn2F_n = F_{n-1} + F_{n-2}).

Core Methods for Identifying Patterns

Method 1: Differences and Ratios

For a numerical sequence, the first thing to check is the difference between consecutive terms.

  • If differences are constant → arithmetic sequence (common difference dd)
  • If ratios are constant → geometric sequence (common ratio rr)
  • If differences are not constant, take the second differences (differences of differences)
    • Constant second differences → quadratic sequence (general term involves n2n^2)
    • Constant third differences → cubic sequence

Example: 1,4,9,16,25,1, 4, 9, 16, 25, \ldots

First differences: 3,5,7,9,3, 5, 7, 9, \ldots (not constant) Second differences: 2,2,2,2, 2, 2, \ldots (constant!)

Second differences are constant → this is a quadratic sequence: Tn=n2T_n = n^2.

Method 2: Look for Symmetry

Many patterns in geometry and algebra exploit symmetry. If an expression looks complex, ask: “Is this symmetric in some variables?” Or: “Does rotating/reflecting this figure give the same thing?”

For algebraic expressions:

  • a2b2=(a+b)(ab)a^2 - b^2 = (a+b)(a-b) — the difference of two perfect squares always factors
  • (a+b)2=a2+2ab+b2(a+b)^2 = a^2 + 2ab + b^2 — the cross term is always twice the product

Recognising these forms instantly tells you the factored version without working it out.

Method 3: Table of Values

For sequences or functions, make a table: nn vs. TnT_n. Sometimes the pattern is in the column of values, sometimes in the ratio of consecutive values, sometimes in the last digits.

nnTnT_nDifference
13
274
3136
4218
53110

Second differences are constant (2), so Tn=an2+bn+cT_n = an^2 + bn + c. Solving: Tn=n2+n+1T_n = n^2 + n + 1.

Method 4: Small Cases First

When a problem seems abstract, start with n=1n = 1, n=2n = 2, n=3n = 3. The pattern almost always reveals itself within 4–5 cases.

This is especially powerful for:

  • Proving divisibility (e.g., n3nn^3 - n is always divisible by 6)
  • Finding the nn-th term of an unusual sequence
  • Predicting the last digit of a large power

Solved Examples

Easy (CBSE Class 9): Find the next two terms

Q: Find the pattern and next two terms: 2,6,12,20,30,2, 6, 12, 20, 30, \ldots

First differences: 4,6,8,10,4, 6, 8, 10, \ldots — these increase by 2 each time.

Next differences: 12,1412, 14

Next two terms: 30+12=4230 + 12 = 42, and 42+14=5642 + 14 = 56.

Pattern: Tn=n(n+1)T_n = n(n+1). Check: T1=2T_1 = 2, T2=6T_2 = 6, T3=12T_3 = 12. ✓

Medium (CBSE Class 10): Find the nn-th term

Q: Find the nn-th term of 5,14,27,44,65,5, 14, 27, 44, 65, \ldots

First differences: 9,13,17,21,9, 13, 17, 21, \ldots (arithmetic, common difference 4) Second differences: 4,4,4,4, 4, 4, \ldots → quadratic sequence.

Let Tn=an2+bn+cT_n = an^2 + bn + c.

From T1=5T_1 = 5: a+b+c=5a + b + c = 5 From T2=14T_2 = 14: 4a+2b+c=144a + 2b + c = 14 From T3=27T_3 = 27: 9a+3b+c=279a + 3b + c = 27

Subtracting: 3a+b=93a + b = 9 and 5a+b=135a + b = 132a=42a = 4a=2a = 2. Then b=96=3b = 9 - 6 = 3 and c=523=0c = 5 - 2 - 3 = 0.

Tn=2n2+3nT_n = 2n^2 + 3n

Check: T4=32+12=44T_4 = 32 + 12 = 44

Hard (JEE Main level): Last digit pattern

Q: Find the last digit of 720247^{2024}.

Powers of 7 (last digits): 71=77^1 = 7, 72=497^2 = 49 (last digit 9), 73=3437^3 = 343 (last digit 3), 74=24017^4 = 2401 (last digit 1), 75=77^5 = \ldots7, 76=97^6 = \ldots9, …

The last digits cycle: 7,9,3,1,7,9,3,1,7, 9, 3, 1, 7, 9, 3, 1, \ldots with period 4.

2024÷4=5062024 \div 4 = 506 remainder 00. Remainder 0 corresponds to the 4th position in the cycle.

Last digit of 720247^{2024} = last digit of 747^4 = 1.

Exam-Specific Tips

JEE Main: Pattern questions often appear in sequences (AP/GP/AGP) and in the “last digit” or “remainder” form. The nn-th term approach and cyclicity of powers are both tested. 2–3 marks per question.

CBSE Class 10: Sequences are examined through AP — finding the general term, sum of nn terms, and word problems. Pattern recognition within AP is the core skill.

CBSE Class 12: Mathematical induction is where pattern recognition gets formal. You observe a pattern, conjecture a formula, then prove it by induction.

Common Mistakes to Avoid

Mistake 1: Guessing from too few terms. Two terms define infinitely many patterns. Three terms narrow it down considerably; four is usually enough. Always verify with at least one term beyond your analysis.

Mistake 2: Assuming arithmetic when differences aren’t constant. Always check second differences before concluding there’s no pattern.

Mistake 3: Not writing the general term. Identifying the next term is not enough in JEE/CBSE. Express the pattern as Tn=f(n)T_n = f(n).

Mistake 4: Missing the “wrap-around” in cyclicity problems. For last digit questions, when remainder = 0, the answer is the last position in the cycle (position 4 for a cycle of 4), not position 0.

Mistake 5: Confusing TnT_n with SnS_n. In AP/GP, TnT_n is the nn-th term and SnS_n is the sum of first nn terms. SnSn1=TnS_n - S_{n-1} = T_n — this identity is often the bridge between the two.

Practice Questions

Q1: Find the 10th term of: 1,4,9,16,1, 4, 9, 16, \ldots

Tn=n2T_n = n^2. The 10th term = 102=10010^2 = 100.

Q2: The pattern 3,7,13,21,31,3, 7, 13, 21, 31, \ldots — find TnT_n.

Second differences = 2 (constant) → quadratic. Tn=n2+n+1T_n = n^2 + n + 1. Check: T1=3T_1 = 3, T2=7T_2 = 7 ✓.

Q3: What is the last digit of 31003^{100}?

Powers of 3 last digits: 3, 9, 7, 1, 3, 9, 7, 1 — cycle of 4. 100÷4=25100 \div 4 = 25 remainder 0 → position 4 in cycle → last digit = 1.

Q4: Find the sum of first 20 terms of 2+6+12+20+2 + 6 + 12 + 20 + \ldots

Tn=n(n+1)=n2+nT_n = n(n+1) = n^2 + n. Sum =k=120(k2+k)=2021416+20212=2870+210=3080= \sum_{k=1}^{20}(k^2+k) = \frac{20 \cdot 21 \cdot 41}{6} + \frac{20 \cdot 21}{2} = 2870 + 210 = 3080.

Q5: In a grid, how many squares of all sizes are in a 4×4 chess board?

1×1: 16, 2×2: 9, 3×3: 4, 4×4: 1. Total = 30. Pattern: for n×nn \times n board, total = n(n+1)(2n+1)6\frac{n(n+1)(2n+1)}{6}.

Q6: The sum of first nn natural numbers is n(n+1)2\frac{n(n+1)}{2}. Use this pattern to find 1+2+3++1001 + 2 + 3 + \ldots + 100.

S100=100×1012=5050S_{100} = \frac{100 \times 101}{2} = 5050.

Q7: Find the number of diagonals in a polygon with nn sides using pattern recognition (start with n=3,4,5n = 3, 4, 5).

Triangle (n=3): 0 diagonals. Quadrilateral (n=4): 2. Pentagon (n=5): 5. Hexagon (n=6): 9. Differences: 2, 3, 4 — each new side adds one more diagonal than before. General formula: n(n3)2\frac{n(n-3)}{2}.

Q8: What comes next: 1,1,2,3,5,8,13,1, 1, 2, 3, 5, 8, 13, \ldots?

Fibonacci sequence: each term = sum of previous two. Next term = 13+8=2113 + 8 = \mathbf{21}.

Additional Techniques

Telescoping via Pattern Recognition

Sometimes a series that looks complex telescopes beautifully once you spot the pattern.

Q: Find 11×2+12×3+13×4++1n(n+1)\frac{1}{1 \times 2} + \frac{1}{2 \times 3} + \frac{1}{3 \times 4} + \cdots + \frac{1}{n(n+1)}.

1k(k+1)=1k1k+1\frac{1}{k(k+1)} = \frac{1}{k} - \frac{1}{k+1} — each term splits into a difference.

(112)+(1213)++(1n1n+1)=11n+1=nn+1(1 - \frac{1}{2}) + (\frac{1}{2} - \frac{1}{3}) + \cdots + (\frac{1}{n} - \frac{1}{n+1}) = 1 - \frac{1}{n+1} = \frac{n}{n+1}

Digit Pattern Problems

Q: What is the units digit of 2100+31002^{100} + 3^{100}?

Powers of 2 (last digits): 2, 4, 8, 6, 2, 4, 8, 6… cycle of 4. 100÷4=25100 \div 4 = 25 remainder 0 → position 4 → units digit of 21002^{100} is 6.

Powers of 3 (last digits): 3, 9, 7, 1, 3, 9, 7, 1… cycle of 4. 100÷4=25100 \div 4 = 25 remainder 0 → position 4 → units digit of 31003^{100} is 1.

Units digit of sum: 6+1=76 + 1 = 7.

Base (last digit)CyclePeriod
0, 1, 5, 6Same digit always1
4, 94,6 / 9,12
2, 3, 7, 84-digit cycle4

For any base, find the last digit, look up the cycle, and use exponentmodperiod\text{exponent} \mod \text{period} to find the position.

JEE Main 2024 Shift 2 had a question: “Find the remainder when 720247^{2024} is divided by 5.” The remainders of powers of 7 when divided by 5 cycle as: 2, 4, 3, 1 (period 4). 2024mod4=02024 \mod 4 = 0 → position 4 → remainder is 1. Pattern recognition turns a seemingly impossible calculation into a 30-second problem.

Q9: Find the sum 12+32+52++(2n1)21^2 + 3^2 + 5^2 + \cdots + (2n-1)^2.

The kk-th term is (2k1)2=4k24k+1(2k-1)^2 = 4k^2 - 4k + 1.

S=k=1n(4k24k+1)=4n(n+1)(2n+1)64n(n+1)2+nS = \sum_{k=1}^{n} (4k^2 - 4k + 1) = 4 \cdot \frac{n(n+1)(2n+1)}{6} - 4 \cdot \frac{n(n+1)}{2} + n

=2n(n+1)(2n+1)32n(n+1)+n=n(2n1)(2n+1)3= \frac{2n(n+1)(2n+1)}{3} - 2n(n+1) + n = \frac{n(2n-1)(2n+1)}{3}

Check: n=1n=1: 1×1×33=1=12\frac{1 \times 1 \times 3}{3} = 1 = 1^2. n=2n=2: 2×3×53=10=1+9\frac{2 \times 3 \times 5}{3} = 10 = 1 + 9. Correct.

FAQs

Q: Is pattern recognition tested directly in JEE? Yes — directly in sequence and series (Chapter 9, Class 11), indirectly in integration (recognising standard forms), differentiation, and probability. The faster you see the structure, the fewer steps you write.

Q: How is pattern recognition different from induction? Pattern recognition is the discovery phase — you observe and conjecture a formula. Mathematical induction is the proof phase — you rigorously verify the conjecture holds for all natural numbers. Both skills are needed for Class 12 boards.

Q: What’s the best way to practise pattern recognition? Solve sequence problems without looking at the solution first. Force yourself to find at least two different approaches. Work through puzzles like Sudoku and KenKen — they train your brain to find structural constraints quickly.

Q: Can pattern recognition be used in algebra? Absolutely. Recognising (a+b)2(a+b)^2, (ab)2(a-b)^2, and a2b2a^2-b^2 patterns in expressions lets you factorise immediately. The same applies to recognising arithmetic or geometric progressions hidden inside sums.

Q: How do cyclicity patterns work for last digits? Any integer’s last digit repeats with a period of at most 4 when the integer is raised to increasing powers. Find the cycle length (1, 2, or 4), then find the remainder when the exponent is divided by the cycle length. Remainder = 0 → last position in cycle.

Practice Questions